methyl 4-[2-(1,3-oxazol-5-yl)phenyl]-4-oxobutanoate

C14H13NO4 — CID 130383140

IUPACmethyl 4-[2-(1,3-oxazol-5-yl)phenyl]-4-oxobutanoate
SMILESCOC(=O)CCC(=O)c1ccccc1-c1cnco1
InChIInChI=1S/C14H13NO4/c1-18-14(17)7-6-12(16)10-4-2-3-5-11(10)13-8-15-9-19-13/h2-5,8-9H,6-7H2,1H3
InChIKeyABUWQCXWYIVXOI-UHFFFAOYSA-N
MW259.26 g/mol
LogP2.48
Rot. Bonds5

About methyl 4-[2-(1,3-oxazol-5-yl)phenyl]-4-oxobutanoate

methyl 4-[2-(1,3-oxazol-5-yl)phenyl]-4-oxobutanoate (PubChem CID 130383140) has the molecular formula C14H13NO4 and a molecular weight of 259.26 g/mol. Its IUPAC name is methyl 4-[2-(1,3-oxazol-5-yl)phenyl]-4-oxobutanoate.

Molecular Properties

Compound Namemethyl 4-[2-(1,3-oxazol-5-yl)phenyl]-4-oxobutanoate
PubChem CID130383140
Molecular FormulaC14H13NO4
Molecular Weight259.26 g/mol
Exact Mass259.08
IUPAC Namemethyl 4-[2-(1,3-oxazol-5-yl)phenyl]-4-oxobutanoate
SMILESCOC(=O)CCC(=O)c1ccccc1-c1cnco1
InChIInChI=1S/C14H13NO4/c1-18-14(17)7-6-12(16)10-4-2-3-5-11(10)13-8-15-9-19-13/h2-5,8-9H,6-7H2,1H3
InChIKeyABUWQCXWYIVXOI-UHFFFAOYSA-N
XLogP2.48
TPSA69.40 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.26
LogP ≤ 52.48
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 4-[2-(1,3-oxazol-5-yl)phenyl]-4-oxobutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[2-(1,3-oxazol-5-yl)phenyl]-4-oxobutanoate?
The IUPAC name of methyl 4-[2-(1,3-oxazol-5-yl)phenyl]-4-oxobutanoate (CID 130383140) is methyl 4-[2-(1,3-oxazol-5-yl)phenyl]-4-oxobutanoate.
What is the SMILES notation for methyl 4-[2-(1,3-oxazol-5-yl)phenyl]-4-oxobutanoate?
The canonical SMILES for methyl 4-[2-(1,3-oxazol-5-yl)phenyl]-4-oxobutanoate is COC(=O)CCC(=O)c1ccccc1-c1cnco1.
What is the InChIKey of methyl 4-[2-(1,3-oxazol-5-yl)phenyl]-4-oxobutanoate?
The InChIKey is ABUWQCXWYIVXOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO4/c1-18-14(17)7-6-12(16)10-4-2-3-5-11(10)13-8-15-9-19-13/h2-5,8-9H,6-7H2,1H3.
What are the key properties of methyl 4-[2-(1,3-oxazol-5-yl)phenyl]-4-oxobutanoate?
methyl 4-[2-(1,3-oxazol-5-yl)phenyl]-4-oxobutanoate has a molecular weight of 259.26 g/mol, XLogP of 2.48, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[2-(1,3-oxazol-5-yl)phenyl]-4-oxobutanoate is sourced from PubChem (CID 130383140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).