C21H27N5O5 — CID 130385084
2-tert-butyl-4-[methyl-[4-(3-nitrophenyl)imidazole-1-carbonyl]amino]piperidine-1-carboxylic acid (PubChem CID 130385084) has the molecular formula C21H27N5O5 and a molecular weight of 429.48 g/mol. Its IUPAC name is 2-tert-butyl-4-[methyl-[4-(3-nitrophenyl)imidazole-1-carbonyl]amino]piperidine-1-carboxylic acid.
| Compound Name | 2-tert-butyl-4-[methyl-[4-(3-nitrophenyl)imidazole-1-carbonyl]amino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 130385084 |
| Molecular Formula | C21H27N5O5 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | 2-tert-butyl-4-[methyl-[4-(3-nitrophenyl)imidazole-1-carbonyl]amino]piperidine-1-carboxylic acid |
| SMILES | CN(C(=O)n1cnc(-c2cccc([N+](=O)[O-])c2)c1)C1CCN(C(=O)O)C(C(C)(C)C)C1 |
| InChI | InChI=1S/C21H27N5O5/c1-21(2,3)18-11-15(8-9-25(18)20(28)29)23(4)19(27)24-12-17(22-13-24)14-6-5-7-16(10-14)26(30)31/h5-7,10,12-13,15,18H,8-9,11H2,1-4H3,(H,28,29) |
| InChIKey | NQIYXKGDERTJJL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 121.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|