C26H42N2O3S — CID 130387628
piperazin-1-yl-[4-[2,4,6-tri(propan-2-yl)phenyl]sulfonylcyclohexyl]methanone (PubChem CID 130387628) has the molecular formula C26H42N2O3S and a molecular weight of 462.70 g/mol. Its IUPAC name is piperazin-1-yl-[4-[2,4,6-tri(propan-2-yl)phenyl]sulfonylcyclohexyl]methanone.
| Compound Name | piperazin-1-yl-[4-[2,4,6-tri(propan-2-yl)phenyl]sulfonylcyclohexyl]methanone |
|---|---|
| PubChem CID | 130387628 |
| Molecular Formula | C26H42N2O3S |
| Molecular Weight | 462.70 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | piperazin-1-yl-[4-[2,4,6-tri(propan-2-yl)phenyl]sulfonylcyclohexyl]methanone |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)C2CCC(C(=O)N3CCNCC3)CC2)c(C(C)C)c1 |
| InChI | InChI=1S/C26H42N2O3S/c1-17(2)21-15-23(18(3)4)25(24(16-21)19(5)6)32(30,31)22-9-7-20(8-10-22)26(29)28-13-11-27-12-14-28/h15-20,22,27H,7-14H2,1-6H3 |
| InChIKey | VJIQMWKPUHAOJT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.70 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |