C18H25NO2 — CID 130387830
2-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-1-cyclopropyl-1-phenylethanol (PubChem CID 130387830) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is 2-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-1-cyclopropyl-1-phenylethanol.
| Compound Name | 2-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-1-cyclopropyl-1-phenylethanol |
|---|---|
| PubChem CID | 130387830 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 2-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-1-cyclopropyl-1-phenylethanol |
| SMILES | OC(CO[C@H]1CN2CCC1CC2)(c1ccccc1)C1CC1 |
| InChI | InChI=1S/C18H25NO2/c20-18(16-6-7-16,15-4-2-1-3-5-15)13-21-17-12-19-10-8-14(17)9-11-19/h1-5,14,16-17,20H,6-13H2/t17-,18?/m0/s1 |
| InChIKey | SGWALAKNEKTNQH-ZENAZSQFSA-N |
| XLogP | 2.39 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |