C27H36NO3+ — CID 122502560
1-cyclopentyl-2-[[(3S)-1-(phenoxymethyl)-1-azoniabicyclo[2.2.2]octan-3-yl]oxy]-1-phenylethanol (PubChem CID 122502560) has the molecular formula C27H36NO3+ and a molecular weight of 422.59 g/mol. Its IUPAC name is 1-cyclopentyl-2-[[(3S)-1-(phenoxymethyl)-1-azoniabicyclo[2.2.2]octan-3-yl]oxy]-1-phenylethanol.
| Compound Name | 1-cyclopentyl-2-[[(3S)-1-(phenoxymethyl)-1-azoniabicyclo[2.2.2]octan-3-yl]oxy]-1-phenylethanol |
|---|---|
| PubChem CID | 122502560 |
| Molecular Formula | C27H36NO3+ |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | 1-cyclopentyl-2-[[(3S)-1-(phenoxymethyl)-1-azoniabicyclo[2.2.2]octan-3-yl]oxy]-1-phenylethanol |
| SMILES | OC(CO[C@@H]1C[N+]2(COc3ccccc3)CCC1CC2)(c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C27H36NO3/c29-27(24-11-7-8-12-24,23-9-3-1-4-10-23)20-30-26-19-28(17-15-22(26)16-18-28)21-31-25-13-5-2-6-14-25/h1-6,9-10,13-14,22,24,26,29H,7-8,11-12,15-21H2/q+1/t22?,26-,27?,28?/m1/s1 |
| InChIKey | HCIUPLIUGVOOEF-KKQTWJLVSA-N |
| XLogP | 4.73 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|