C29H41N2O3+ — CID 122502567
3-(2-cyclopentyl-2-methoxy-2-pyridin-3-ylethoxy)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octane (PubChem CID 122502567) has the molecular formula C29H41N2O3+ and a molecular weight of 465.66 g/mol. Its IUPAC name is 3-(2-cyclopentyl-2-methoxy-2-pyridin-3-ylethoxy)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octane.
| Compound Name | 3-(2-cyclopentyl-2-methoxy-2-pyridin-3-ylethoxy)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 122502567 |
| Molecular Formula | C29H41N2O3+ |
| Molecular Weight | 465.66 g/mol |
| Exact Mass | 465.31 |
| IUPAC Name | 3-(2-cyclopentyl-2-methoxy-2-pyridin-3-ylethoxy)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octane |
| SMILES | COC(COC1C[N+]2(CCCOc3ccccc3)CCC1CC2)(c1cccnc1)C1CCCC1 |
| InChI | InChI=1S/C29H41N2O3/c1-32-29(25-9-5-6-10-25,26-11-7-16-30-21-26)23-34-28-22-31(18-14-24(28)15-19-31)17-8-20-33-27-12-3-2-4-13-27/h2-4,7,11-13,16,21,24-25,28H,5-6,8-10,14-15,17-20,22-23H2,1H3/q+1 |
| InChIKey | MYHGQNZNWXSRRD-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.66 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|