C29H39BrClNO2 — CID 160699670
3-(2-chloro-2-cyclopentyl-2-phenylethoxy)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octane bromide (PubChem CID 160699670) has the molecular formula C29H39BrClNO2 and a molecular weight of 548.99 g/mol. Its IUPAC name is 3-(2-chloro-2-cyclopentyl-2-phenylethoxy)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octane bromide.
| Compound Name | 3-(2-chloro-2-cyclopentyl-2-phenylethoxy)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octane bromide |
|---|---|
| PubChem CID | 160699670 |
| Molecular Formula | C29H39BrClNO2 |
| Molecular Weight | 548.99 g/mol |
| Exact Mass | 547.19 |
| IUPAC Name | 3-(2-chloro-2-cyclopentyl-2-phenylethoxy)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octane bromide |
| SMILES | ClC(COC1C[N+]2(CCCOc3ccccc3)CCC1CC2)(c1ccccc1)C1CCCC1.[Br-] |
| InChI | InChI=1S/C29H39ClNO2.BrH/c30-29(26-12-7-8-13-26,25-10-3-1-4-11-25)23-33-28-22-31(19-16-24(28)17-20-31)18-9-21-32-27-14-5-2-6-15-27;/h1-6,10-11,14-15,24,26,28H,7-9,12-13,16-23H2;1H/q+1;/p-1 |
| InChIKey | XDNFRHJMPABQNW-UHFFFAOYSA-M |
| XLogP | 3.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.99 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|