C30H38NO3+ — CID 122502583
1-(2-methylcyclopenta-2,4-dien-1-yl)-2-[[1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl]oxy]-1-phenylethanol (PubChem CID 122502583) has the molecular formula C30H38NO3+ and a molecular weight of 460.64 g/mol. Its IUPAC name is 1-(2-methylcyclopenta-2,4-dien-1-yl)-2-[[1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl]oxy]-1-phenylethanol.
| Compound Name | 1-(2-methylcyclopenta-2,4-dien-1-yl)-2-[[1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl]oxy]-1-phenylethanol |
|---|---|
| PubChem CID | 122502583 |
| Molecular Formula | C30H38NO3+ |
| Molecular Weight | 460.64 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | 1-(2-methylcyclopenta-2,4-dien-1-yl)-2-[[1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl]oxy]-1-phenylethanol |
| SMILES | CC1=CC=CC1C(O)(COC1C[N+]2(CCCOc3ccccc3)CCC1CC2)c1ccccc1 |
| InChI | InChI=1S/C30H38NO3/c1-24-10-8-15-28(24)30(32,26-11-4-2-5-12-26)23-34-29-22-31(19-16-25(29)17-20-31)18-9-21-33-27-13-6-3-7-14-27/h2-8,10-15,25,28-29,32H,9,16-23H2,1H3/q+1 |
| InChIKey | HLCXPJLGSIOCDP-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.64 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|