C27H35BrNO3+ — CID 121346870
2-[[(2R,3R)-2-bromo-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl]oxy]-1-cyclopropyl-1-phenylethanol (PubChem CID 121346870) has the molecular formula C27H35BrNO3+ and a molecular weight of 501.49 g/mol. Its IUPAC name is 2-[[(2R,3R)-2-bromo-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl]oxy]-1-cyclopropyl-1-phenylethanol.
| Compound Name | 2-[[(2R,3R)-2-bromo-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl]oxy]-1-cyclopropyl-1-phenylethanol |
|---|---|
| PubChem CID | 121346870 |
| Molecular Formula | C27H35BrNO3+ |
| Molecular Weight | 501.49 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | 2-[[(2R,3R)-2-bromo-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl]oxy]-1-cyclopropyl-1-phenylethanol |
| SMILES | OC(CO[C@@H]1C2CC[N+](CCCOc3ccccc3)(CC2)[C@@H]1Br)(c1ccccc1)C1CC1 |
| InChI | InChI=1S/C27H35BrNO3/c28-26-25(32-20-27(30,23-12-13-23)22-8-3-1-4-9-22)21-14-17-29(26,18-15-21)16-7-19-31-24-10-5-2-6-11-24/h1-6,8-11,21,23,25-26,30H,7,12-20H2/q+1/t21?,25-,26+,27?,29?/m1/s1 |
| InChIKey | IWBNAFTYFNBLID-MTVFHZCYSA-N |
| XLogP | 5.10 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|