C28H37BrNO3+ — CID 121346902
2-[[(2R,3R)-2-bromo-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl]oxy]-1-cyclobutyl-1-phenylethanol (PubChem CID 121346902) has the molecular formula C28H37BrNO3+ and a molecular weight of 515.51 g/mol. Its IUPAC name is 2-[[(2R,3R)-2-bromo-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl]oxy]-1-cyclobutyl-1-phenylethanol.
| Compound Name | 2-[[(2R,3R)-2-bromo-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl]oxy]-1-cyclobutyl-1-phenylethanol |
|---|---|
| PubChem CID | 121346902 |
| Molecular Formula | C28H37BrNO3+ |
| Molecular Weight | 515.51 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | 2-[[(2R,3R)-2-bromo-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl]oxy]-1-cyclobutyl-1-phenylethanol |
| SMILES | OC(CO[C@@H]1C2CC[N+](CCCOc3ccccc3)(CC2)[C@@H]1Br)(c1ccccc1)C1CCC1 |
| InChI | InChI=1S/C28H37BrNO3/c29-27-26(33-21-28(31,24-11-7-12-24)23-9-3-1-4-10-23)22-15-18-30(27,19-16-22)17-8-20-32-25-13-5-2-6-14-25/h1-6,9-10,13-14,22,24,26-27,31H,7-8,11-12,15-21H2/q+1/t22?,26-,27+,28?,30?/m1/s1 |
| InChIKey | MFEWYXXVGHRSNJ-IWHAXEIUSA-N |
| XLogP | 5.49 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.51 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|