C22H33NO2 — CID 163483995
(1S)-2-[[(6R)-1-azabicyclo[3.2.2]nonan-6-yl]oxy]-1-cyclohexyl-1-phenylethanol (PubChem CID 163483995) has the molecular formula C22H33NO2 and a molecular weight of 343.51 g/mol. Its IUPAC name is (1S)-2-[[(6R)-1-azabicyclo[3.2.2]nonan-6-yl]oxy]-1-cyclohexyl-1-phenylethanol.
| Compound Name | (1S)-2-[[(6R)-1-azabicyclo[3.2.2]nonan-6-yl]oxy]-1-cyclohexyl-1-phenylethanol |
|---|---|
| PubChem CID | 163483995 |
| Molecular Formula | C22H33NO2 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | (1S)-2-[[(6R)-1-azabicyclo[3.2.2]nonan-6-yl]oxy]-1-cyclohexyl-1-phenylethanol |
| SMILES | O[C@](CO[C@H]1CN2CCCC1CC2)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C22H33NO2/c24-22(19-9-3-1-4-10-19,20-11-5-2-6-12-20)17-25-21-16-23-14-7-8-18(21)13-15-23/h1,3-4,9-10,18,20-21,24H,2,5-8,11-17H2/t18?,21-,22+/m0/s1 |
| InChIKey | CGZCEMDRJOKSCF-LFZQMPOYSA-N |
| XLogP | 3.96 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |