C56H82O10 — CID 130390499
[2,2-bis[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxymethyl]-3-methoxypropyl] 3-(5-tert-butyl-8,8-dimethyl-7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-3-yl)propanoate (PubChem CID 130390499) has the molecular formula C56H82O10 and a molecular weight of 915.26 g/mol. Its IUPAC name is [2,2-bis[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxymethyl]-3-methoxypropyl] 3-(5-tert-butyl-8,8-dimethyl-7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-3-yl)propanoate.
| Compound Name | [2,2-bis[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxymethyl]-3-methoxypropyl] 3-(5-tert-butyl-8,8-dimethyl-7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-3-yl)propanoate |
|---|---|
| PubChem CID | 130390499 |
| Molecular Formula | C56H82O10 |
| Molecular Weight | 915.26 g/mol |
| Exact Mass | 914.59 |
| IUPAC Name | [2,2-bis[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxymethyl]-3-methoxypropyl] 3-(5-tert-butyl-8,8-dimethyl-7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-3-yl)propanoate |
| SMILES | COCC(COC(=O)CCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)(COC(=O)CCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)COC(=O)CCc1cc(C(C)(C)C)c2c(c1)C(C)(C)O2 |
| InChI | InChI=1S/C56H82O10/c1-50(2,3)38-25-35(26-39(47(38)60)51(4,5)6)19-22-44(57)63-32-56(31-62-18,33-64-45(58)23-20-36-27-40(52(7,8)9)48(61)41(28-36)53(10,11)12)34-65-46(59)24-21-37-29-42(54(13,14)15)49-43(30-37)55(16,17)66-49/h25-30,60-61H,19-24,31-34H2,1-18H3 |
| InChIKey | VHFFYGJOHRCTCF-UHFFFAOYSA-N |
| XLogP | 11.67 |
| TPSA | 137.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 915.26 |
| LogP ≤ 5 | 11.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|