C12H16F3N3S — CID 130390733
1-[2-[(Z)-1-(2,2,2-trifluoroethylideneamino)pent-1-en-3-yl]-1,3-thiazol-5-yl]ethanamine (PubChem CID 130390733) has the molecular formula C12H16F3N3S and a molecular weight of 291.34 g/mol. Its IUPAC name is 1-[2-[(Z)-1-(2,2,2-trifluoroethylideneamino)pent-1-en-3-yl]-1,3-thiazol-5-yl]ethanamine.
| Compound Name | 1-[2-[(Z)-1-(2,2,2-trifluoroethylideneamino)pent-1-en-3-yl]-1,3-thiazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 130390733 |
| Molecular Formula | C12H16F3N3S |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 1-[2-[(Z)-1-(2,2,2-trifluoroethylideneamino)pent-1-en-3-yl]-1,3-thiazol-5-yl]ethanamine |
| SMILES | CCC(/C=C\N=C\C(F)(F)F)c1ncc(C(C)N)s1 |
| InChI | InChI=1S/C12H16F3N3S/c1-3-9(4-5-17-7-12(13,14)15)11-18-6-10(19-11)8(2)16/h4-9H,3,16H2,1-2H3/b5-4-,17-7+ |
| InChIKey | IEEUAIIHXOAAMV-WYPQZIOPSA-N |
| XLogP | 3.80 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|