C23H26ClN5O4 — CID 130391612
(3R,3aR,6R,6aR)-6-[[6-chloro-5-[(1-phenylpiperidin-4-yl)amino]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 130391612) has the molecular formula C23H26ClN5O4 and a molecular weight of 471.95 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-6-[[6-chloro-5-[(1-phenylpiperidin-4-yl)amino]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6R,6aR)-6-[[6-chloro-5-[(1-phenylpiperidin-4-yl)amino]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 130391612 |
| Molecular Formula | C23H26ClN5O4 |
| Molecular Weight | 471.95 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | (3R,3aR,6R,6aR)-6-[[6-chloro-5-[(1-phenylpiperidin-4-yl)amino]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | O[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2Oc1nc2nc(NC3CCN(c4ccccc4)CC3)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C23H26ClN5O4/c24-15-10-16-22(28-23(26-16)33-18-12-32-19-17(30)11-31-20(18)19)27-21(15)25-13-6-8-29(9-7-13)14-4-2-1-3-5-14/h1-5,10,13,17-20,30H,6-9,11-12H2,(H2,25,26,27,28)/t17-,18-,19-,20-/m1/s1 |
| InChIKey | YVDCLBVJSAOJLA-UAFMIMERSA-N |
| XLogP | 2.60 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.95 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |