C39H24N8 — CID 130392885
8-[4-[3-(4,6-dipyridin-2-yl-1,3,5-triazin-2-yl)phenyl]phenyl]-9,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaene (PubChem CID 130392885) has the molecular formula C39H24N8 and a molecular weight of 604.68 g/mol. Its IUPAC name is 8-[4-[3-(4,6-dipyridin-2-yl-1,3,5-triazin-2-yl)phenyl]phenyl]-9,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaene.
| Compound Name | 8-[4-[3-(4,6-dipyridin-2-yl-1,3,5-triazin-2-yl)phenyl]phenyl]-9,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaene |
|---|---|
| PubChem CID | 130392885 |
| Molecular Formula | C39H24N8 |
| Molecular Weight | 604.68 g/mol |
| Exact Mass | 604.21 |
| IUPAC Name | 8-[4-[3-(4,6-dipyridin-2-yl-1,3,5-triazin-2-yl)phenyl]phenyl]-9,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaene |
| SMILES | c1ccc(-c2nc(-c3cccc(-c4ccc(-c5nc6c(nc7ccccn76)c6ccccc56)cc4)c3)nc(-c3ccccn3)n2)nc1 |
| InChI | InChI=1S/C39H24N8/c1-2-13-30-29(12-1)34(43-39-35(30)42-33-16-5-8-23-47(33)39)26-19-17-25(18-20-26)27-10-9-11-28(24-27)36-44-37(31-14-3-6-21-40-31)46-38(45-36)32-15-4-7-22-41-32/h1-24H |
| InChIKey | XWDZXYRDPPQESP-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 94.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.68 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |