C54H35N5 — CID 130393615
8-[4-[3-[4,6-bis(4-phenylphenyl)pyrimidin-2-yl]phenyl]phenyl]-9,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaene (PubChem CID 130393615) has the molecular formula C54H35N5 and a molecular weight of 753.91 g/mol. Its IUPAC name is 8-[4-[3-[4,6-bis(4-phenylphenyl)pyrimidin-2-yl]phenyl]phenyl]-9,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaene.
| Compound Name | 8-[4-[3-[4,6-bis(4-phenylphenyl)pyrimidin-2-yl]phenyl]phenyl]-9,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaene |
|---|---|
| PubChem CID | 130393615 |
| Molecular Formula | C54H35N5 |
| Molecular Weight | 753.91 g/mol |
| Exact Mass | 753.29 |
| IUPAC Name | 8-[4-[3-[4,6-bis(4-phenylphenyl)pyrimidin-2-yl]phenyl]phenyl]-9,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaene |
| SMILES | c1ccc(-c2ccc(-c3cc(-c4ccc(-c5ccccc5)cc4)nc(-c4cccc(-c5ccc(-c6nc7c(nc8ccccn87)c7ccccc67)cc5)c4)n3)cc2)cc1 |
| InChI | InChI=1S/C54H35N5/c1-3-12-36(13-4-1)38-21-27-41(28-22-38)48-35-49(42-29-23-39(24-30-42)37-14-5-2-6-15-37)56-53(55-48)45-17-11-16-44(34-45)40-25-31-43(32-26-40)51-46-18-7-8-19-47(46)52-54(58-51)59-33-10-9-20-50(59)57-52/h1-35H |
| InChIKey | NUBRHBAMIBEHBL-UHFFFAOYSA-N |
| XLogP | 13.49 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.91 |
| LogP ≤ 5 | 13.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |