C38H26N3OP — CID 130393588
8-[3-(3-diphenylphosphorylphenyl)phenyl]-9,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaene (PubChem CID 130393588) has the molecular formula C38H26N3OP and a molecular weight of 571.62 g/mol. Its IUPAC name is 8-[3-(3-diphenylphosphorylphenyl)phenyl]-9,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaene.
| Compound Name | 8-[3-(3-diphenylphosphorylphenyl)phenyl]-9,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaene |
|---|---|
| PubChem CID | 130393588 |
| Molecular Formula | C38H26N3OP |
| Molecular Weight | 571.62 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | 8-[3-(3-diphenylphosphorylphenyl)phenyl]-9,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaene |
| SMILES | O=P(c1ccccc1)(c1ccccc1)c1cccc(-c2cccc(-c3nc4c(nc5ccccn54)c4ccccc34)c2)c1 |
| InChI | InChI=1S/C38H26N3OP/c42-43(30-16-3-1-4-17-30,31-18-5-2-6-19-31)32-20-12-14-28(26-32)27-13-11-15-29(25-27)36-33-21-7-8-22-34(33)37-38(40-36)41-24-10-9-23-35(41)39-37/h1-26H |
| InChIKey | NQCKLOLSWJSDGD-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.62 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|