C32H23N3OP+ — CID 130393760
hydroxy-diphenyl-[3-(9,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaen-8-yl)phenyl]phosphanium (PubChem CID 130393760) has the molecular formula C32H23N3OP+ and a molecular weight of 496.53 g/mol. Its IUPAC name is hydroxy-diphenyl-[3-(9,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaen-8-yl)phenyl]phosphanium.
| Compound Name | hydroxy-diphenyl-[3-(9,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaen-8-yl)phenyl]phosphanium |
|---|---|
| PubChem CID | 130393760 |
| Molecular Formula | C32H23N3OP+ |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | hydroxy-diphenyl-[3-(9,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaen-8-yl)phenyl]phosphanium |
| SMILES | O[P+](c1ccccc1)(c1ccccc1)c1cccc(-c2nc3c(nc4ccccn43)c3ccccc23)c1 |
| InChI | InChI=1S/C32H23N3OP/c36-37(24-13-3-1-4-14-24,25-15-5-2-6-16-25)26-17-11-12-23(22-26)30-27-18-7-8-19-28(27)31-32(34-30)35-21-10-9-20-29(35)33-31/h1-22,36H/q+1 |
| InChIKey | ZXBHXBVTWSADEJ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|