C37H24N4 — CID 130392921
8-[4-(2,6-diphenyl-4-pyridinyl)phenyl]-9,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaene (PubChem CID 130392921) has the molecular formula C37H24N4 and a molecular weight of 524.63 g/mol. Its IUPAC name is 8-[4-(2,6-diphenyl-4-pyridinyl)phenyl]-9,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaene.
| Compound Name | 8-[4-(2,6-diphenyl-4-pyridinyl)phenyl]-9,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaene |
|---|---|
| PubChem CID | 130392921 |
| Molecular Formula | C37H24N4 |
| Molecular Weight | 524.63 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | 8-[4-(2,6-diphenyl-4-pyridinyl)phenyl]-9,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaene |
| SMILES | c1ccc(-c2cc(-c3ccc(-c4nc5c(nc6ccccn65)c5ccccc45)cc3)cc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C37H24N4/c1-3-11-26(12-4-1)32-23-29(24-33(38-32)27-13-5-2-6-14-27)25-18-20-28(21-19-25)35-30-15-7-8-16-31(30)36-37(40-35)41-22-10-9-17-34(41)39-36/h1-24H |
| InChIKey | PVWGQGBYUUYYCL-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.63 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |