C14H19FN2O3 — CID 130394504
N-[1-(2-fluoro-4-methoxyphenyl)propan-2-yl]-2-formamidopropanamide (PubChem CID 130394504) has the molecular formula C14H19FN2O3 and a molecular weight of 282.31 g/mol. Its IUPAC name is N-[1-(2-fluoro-4-methoxyphenyl)propan-2-yl]-2-formamidopropanamide.
| Compound Name | N-[1-(2-fluoro-4-methoxyphenyl)propan-2-yl]-2-formamidopropanamide |
|---|---|
| PubChem CID | 130394504 |
| Molecular Formula | C14H19FN2O3 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | N-[1-(2-fluoro-4-methoxyphenyl)propan-2-yl]-2-formamidopropanamide |
| SMILES | COc1ccc(CC(C)NC(=O)C(C)NC=O)c(F)c1 |
| InChI | InChI=1S/C14H19FN2O3/c1-9(17-14(19)10(2)16-8-18)6-11-4-5-12(20-3)7-13(11)15/h4-5,7-10H,6H2,1-3H3,(H,16,18)(H,17,19) |
| InChIKey | KZJZYRGUEHSFOT-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|