C25H23ClN2O2 — CID 130394761
2-chloro-13-cyclohexyl-6-formyl-7H-indolo[2,1-a][2]benzazepine-10-carboxamide (PubChem CID 130394761) has the molecular formula C25H23ClN2O2 and a molecular weight of 418.92 g/mol. Its IUPAC name is 2-chloro-13-cyclohexyl-6-formyl-7H-indolo[2,1-a][2]benzazepine-10-carboxamide.
| Compound Name | 2-chloro-13-cyclohexyl-6-formyl-7H-indolo[2,1-a][2]benzazepine-10-carboxamide |
|---|---|
| PubChem CID | 130394761 |
| Molecular Formula | C25H23ClN2O2 |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 2-chloro-13-cyclohexyl-6-formyl-7H-indolo[2,1-a][2]benzazepine-10-carboxamide |
| SMILES | NC(=O)c1ccc2c(C3CCCCC3)c3n(c2c1)CC(C=O)=Cc1ccc(Cl)cc1-3 |
| InChI | InChI=1S/C25H23ClN2O2/c26-19-8-6-17-10-15(14-29)13-28-22-11-18(25(27)30)7-9-20(22)23(24(28)21(17)12-19)16-4-2-1-3-5-16/h6-12,14,16H,1-5,13H2,(H2,27,30) |
| InChIKey | ARIFMLVHGHUAGT-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|