C31H29FN4O — CID 143615913
3-cyclohexyl-17-(2-fluorophenyl)-10,13,18-triazapentacyclo[12.7.0.02,10.04,9.015,19]henicosa-1(14),2,4(9),5,7,15(19),16,20-octaene-7-carboxamide (PubChem CID 143615913) has the molecular formula C31H29FN4O and a molecular weight of 492.60 g/mol. Its IUPAC name is 3-cyclohexyl-17-(2-fluorophenyl)-10,13,18-triazapentacyclo[12.7.0.02,10.04,9.015,19]henicosa-1(14),2,4(9),5,7,15(19),16,20-octaene-7-carboxamide.
| Compound Name | 3-cyclohexyl-17-(2-fluorophenyl)-10,13,18-triazapentacyclo[12.7.0.02,10.04,9.015,19]henicosa-1(14),2,4(9),5,7,15(19),16,20-octaene-7-carboxamide |
|---|---|
| PubChem CID | 143615913 |
| Molecular Formula | C31H29FN4O |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | 3-cyclohexyl-17-(2-fluorophenyl)-10,13,18-triazapentacyclo[12.7.0.02,10.04,9.015,19]henicosa-1(14),2,4(9),5,7,15(19),16,20-octaene-7-carboxamide |
| SMILES | NC(=O)c1ccc2c(C3CCCCC3)c3n(c2c1)CCNc1c-3ccc2[nH]c(-c3ccccc3F)cc12 |
| InChI | InChI=1S/C31H29FN4O/c32-24-9-5-4-8-20(24)26-17-23-25(35-26)13-12-22-29(23)34-14-15-36-27-16-19(31(33)37)10-11-21(27)28(30(22)36)18-6-2-1-3-7-18/h4-5,8-13,16-18,34-35H,1-3,6-7,14-15H2,(H2,33,37) |
| InChIKey | UCARQSYOEDBWSN-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |