C33H29F3N2O3 — CID 59664807
3-cyclohexyl-17-[3-(trifluoromethoxy)phenyl]-10,18-diazapentacyclo[12.7.0.02,10.04,9.015,19]henicosa-1(14),2,4(9),5,7,15(19),16,20-octaene-7-carboxylic acid (PubChem CID 59664807) has the molecular formula C33H29F3N2O3 and a molecular weight of 558.60 g/mol. Its IUPAC name is 3-cyclohexyl-17-[3-(trifluoromethoxy)phenyl]-10,18-diazapentacyclo[12.7.0.02,10.04,9.015,19]henicosa-1(14),2,4(9),5,7,15(19),16,20-octaene-7-carboxylic acid.
| Compound Name | 3-cyclohexyl-17-[3-(trifluoromethoxy)phenyl]-10,18-diazapentacyclo[12.7.0.02,10.04,9.015,19]henicosa-1(14),2,4(9),5,7,15(19),16,20-octaene-7-carboxylic acid |
|---|---|
| PubChem CID | 59664807 |
| Molecular Formula | C33H29F3N2O3 |
| Molecular Weight | 558.60 g/mol |
| Exact Mass | 558.21 |
| IUPAC Name | 3-cyclohexyl-17-[3-(trifluoromethoxy)phenyl]-10,18-diazapentacyclo[12.7.0.02,10.04,9.015,19]henicosa-1(14),2,4(9),5,7,15(19),16,20-octaene-7-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(C3CCCCC3)c3n(c2c1)CCCc1c-3ccc2[nH]c(-c3cccc(OC(F)(F)F)c3)cc12 |
| InChI | InChI=1S/C33H29F3N2O3/c34-33(35,36)41-22-9-4-8-20(16-22)28-18-26-23-10-5-15-38-29-17-21(32(39)40)11-12-25(29)30(19-6-2-1-3-7-19)31(38)24(23)13-14-27(26)37-28/h4,8-9,11-14,16-19,37H,1-3,5-7,10,15H2,(H,39,40) |
| InChIKey | XUXSFAWANVYQFA-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 67.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.60 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |