C21H23N3O2 — CID 58765233
17-cyclohexyl-3,6,10-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(17),2,4,11(16),12,14-hexaene-13-carboxylic acid (PubChem CID 58765233) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is 17-cyclohexyl-3,6,10-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(17),2,4,11(16),12,14-hexaene-13-carboxylic acid.
| Compound Name | 17-cyclohexyl-3,6,10-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(17),2,4,11(16),12,14-hexaene-13-carboxylic acid |
|---|---|
| PubChem CID | 58765233 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 17-cyclohexyl-3,6,10-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(17),2,4,11(16),12,14-hexaene-13-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(C3CCCCC3)c3n(c2c1)CCCn1ccnc1-3 |
| InChI | InChI=1S/C21H23N3O2/c25-21(26)15-7-8-16-17(13-15)24-11-4-10-23-12-9-22-20(23)19(24)18(16)14-5-2-1-3-6-14/h7-9,12-14H,1-6,10-11H2,(H,25,26) |
| InChIKey | NWDVQFHZPYZHRB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|