C36H41N5O4 — CID 58677134
3-[4-[[1-[(17-cyclohexyl-3,6,10-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(17),2,4,11(16),12,14-hexaene-13-carbonyl)amino]cyclopentanecarbonyl]amino]phenyl]propanoic acid (PubChem CID 58677134) has the molecular formula C36H41N5O4 and a molecular weight of 607.76 g/mol. Its IUPAC name is 3-[4-[[1-[(17-cyclohexyl-3,6,10-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(17),2,4,11(16),12,14-hexaene-13-carbonyl)amino]cyclopentanecarbonyl]amino]phenyl]propanoic acid.
| Compound Name | 3-[4-[[1-[(17-cyclohexyl-3,6,10-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(17),2,4,11(16),12,14-hexaene-13-carbonyl)amino]cyclopentanecarbonyl]amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 58677134 |
| Molecular Formula | C36H41N5O4 |
| Molecular Weight | 607.76 g/mol |
| Exact Mass | 607.32 |
| IUPAC Name | 3-[4-[[1-[(17-cyclohexyl-3,6,10-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(17),2,4,11(16),12,14-hexaene-13-carbonyl)amino]cyclopentanecarbonyl]amino]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(NC(=O)C2(NC(=O)c3ccc4c(C5CCCCC5)c5n(c4c3)CCCn3ccnc3-5)CCCC2)cc1 |
| InChI | InChI=1S/C36H41N5O4/c42-30(43)16-11-24-9-13-27(14-10-24)38-35(45)36(17-4-5-18-36)39-34(44)26-12-15-28-29(23-26)41-21-6-20-40-22-19-37-33(40)32(41)31(28)25-7-2-1-3-8-25/h9-10,12-15,19,22-23,25H,1-8,11,16-18,20-21H2,(H,38,45)(H,39,44)(H,42,43) |
| InChIKey | UHRNINAJEPVJHL-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 118.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.76 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|