C32H32N4O2 — CID 143615946
3-cyclohexyl-17-(4-methoxyphenyl)-10,13,18-triazapentacyclo[12.7.0.02,10.04,9.015,19]henicosa-1(14),2,4(9),5,7,15(19),16,20-octaene-7-carboxamide (PubChem CID 143615946) has the molecular formula C32H32N4O2 and a molecular weight of 504.63 g/mol. Its IUPAC name is 3-cyclohexyl-17-(4-methoxyphenyl)-10,13,18-triazapentacyclo[12.7.0.02,10.04,9.015,19]henicosa-1(14),2,4(9),5,7,15(19),16,20-octaene-7-carboxamide.
| Compound Name | 3-cyclohexyl-17-(4-methoxyphenyl)-10,13,18-triazapentacyclo[12.7.0.02,10.04,9.015,19]henicosa-1(14),2,4(9),5,7,15(19),16,20-octaene-7-carboxamide |
|---|---|
| PubChem CID | 143615946 |
| Molecular Formula | C32H32N4O2 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | 3-cyclohexyl-17-(4-methoxyphenyl)-10,13,18-triazapentacyclo[12.7.0.02,10.04,9.015,19]henicosa-1(14),2,4(9),5,7,15(19),16,20-octaene-7-carboxamide |
| SMILES | COc1ccc(-c2cc3c4c(ccc3[nH]2)-c2c(C3CCCCC3)c3ccc(C(N)=O)cc3n2CCN4)cc1 |
| InChI | InChI=1S/C32H32N4O2/c1-38-22-10-7-19(8-11-22)27-18-25-26(35-27)14-13-24-30(25)34-15-16-36-28-17-21(32(33)37)9-12-23(28)29(31(24)36)20-5-3-2-4-6-20/h7-14,17-18,20,34-35H,2-6,15-16H2,1H3,(H2,33,37) |
| InChIKey | ZIQOMLLWUDVUOB-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |