C11H22N2O3 — CID 130401899
methyl N-[2,2-dimethylbutanoyl(propan-2-yl)amino]carbamate (PubChem CID 130401899) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is methyl N-[2,2-dimethylbutanoyl(propan-2-yl)amino]carbamate.
| Compound Name | methyl N-[2,2-dimethylbutanoyl(propan-2-yl)amino]carbamate |
|---|---|
| PubChem CID | 130401899 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | methyl N-[2,2-dimethylbutanoyl(propan-2-yl)amino]carbamate |
| SMILES | CCC(C)(C)C(=O)N(NC(=O)OC)C(C)C |
| InChI | InChI=1S/C11H22N2O3/c1-7-11(4,5)9(14)13(8(2)3)12-10(15)16-6/h8H,7H2,1-6H3,(H,12,15) |
| InChIKey | YFKSRAAXANUTIB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|