C8H15N3S2 — CID 130404253
3,3-dimethyl-4-(methyldisulfanyl)piperazine-1-carbonitrile (PubChem CID 130404253) has the molecular formula C8H15N3S2 and a molecular weight of 217.36 g/mol. Its IUPAC name is 3,3-dimethyl-4-(methyldisulfanyl)piperazine-1-carbonitrile.
| Compound Name | 3,3-dimethyl-4-(methyldisulfanyl)piperazine-1-carbonitrile |
|---|---|
| PubChem CID | 130404253 |
| Molecular Formula | C8H15N3S2 |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 3,3-dimethyl-4-(methyldisulfanyl)piperazine-1-carbonitrile |
| SMILES | CSSN1CCN(C#N)CC1(C)C |
| InChI | InChI=1S/C8H15N3S2/c1-8(2)6-10(7-9)4-5-11(8)13-12-3/h4-6H2,1-3H3 |
| InChIKey | YEVOTVFCVGPXIY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|