C19H34FN3O2 — CID 87529611
1-(4-fluoro-2,2,6,6-tetramethylpiperidin-1-yl)peroxy-2,2,6,6-tetramethylpiperidine-4-carbonitrile (PubChem CID 87529611) has the molecular formula C19H34FN3O2 and a molecular weight of 355.50 g/mol. Its IUPAC name is 1-(4-fluoro-2,2,6,6-tetramethylpiperidin-1-yl)peroxy-2,2,6,6-tetramethylpiperidine-4-carbonitrile.
| Compound Name | 1-(4-fluoro-2,2,6,6-tetramethylpiperidin-1-yl)peroxy-2,2,6,6-tetramethylpiperidine-4-carbonitrile |
|---|---|
| PubChem CID | 87529611 |
| Molecular Formula | C19H34FN3O2 |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.26 |
| IUPAC Name | 1-(4-fluoro-2,2,6,6-tetramethylpiperidin-1-yl)peroxy-2,2,6,6-tetramethylpiperidine-4-carbonitrile |
| SMILES | CC1(C)CC(F)CC(C)(C)N1OON1C(C)(C)CC(C#N)CC1(C)C |
| InChI | InChI=1S/C19H34FN3O2/c1-16(2)9-14(13-21)10-17(3,4)22(16)24-25-23-18(5,6)11-15(20)12-19(23,7)8/h14-15H,9-12H2,1-8H3 |
| InChIKey | WVWJNTWWHRDOII-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 48.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|