About 2-ethyl-1-methoxy-2,5,5-trimethylpyrrolidine-3-carbonitrile
2-ethyl-1-methoxy-2,5,5-trimethylpyrrolidine-3-carbonitrile (PubChem CID 123958706) has the molecular formula C11H20N2O
and a molecular weight of 196.29 g/mol. Its IUPAC name is 2-ethyl-1-methoxy-2,5,5-trimethylpyrrolidine-3-carbonitrile.
Molecular Properties
| Compound Name | 2-ethyl-1-methoxy-2,5,5-trimethylpyrrolidine-3-carbonitrile |
| PubChem CID | 123958706 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 2-ethyl-1-methoxy-2,5,5-trimethylpyrrolidine-3-carbonitrile |
| SMILES | CCC1(C)C(C#N)CC(C)(C)N1OC |
| InChI | InChI=1S/C11H20N2O/c1-6-11(4)9(8-12)7-10(2,3)13(11)14-5/h9H,6-7H2,1-5H3 |
| InChIKey | DDDKTCKWMITGGR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-1-methoxy-2,5,5-trimethylpyrrolidine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1-methoxy-2,5,5-trimethylpyrrolidine-3-carbonitrile?
The IUPAC name of 2-ethyl-1-methoxy-2,5,5-trimethylpyrrolidine-3-carbonitrile (CID 123958706) is 2-ethyl-1-methoxy-2,5,5-trimethylpyrrolidine-3-carbonitrile.
What is the SMILES notation for 2-ethyl-1-methoxy-2,5,5-trimethylpyrrolidine-3-carbonitrile?
The canonical SMILES for 2-ethyl-1-methoxy-2,5,5-trimethylpyrrolidine-3-carbonitrile is CCC1(C)C(C#N)CC(C)(C)N1OC.
What is the InChIKey of 2-ethyl-1-methoxy-2,5,5-trimethylpyrrolidine-3-carbonitrile?
The InChIKey is DDDKTCKWMITGGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O/c1-6-11(4)9(8-12)7-10(2,3)13(11)14-5/h9H,6-7H2,1-5H3.
What are the key properties of 2-ethyl-1-methoxy-2,5,5-trimethylpyrrolidine-3-carbonitrile?
2-ethyl-1-methoxy-2,5,5-trimethylpyrrolidine-3-carbonitrile has a molecular weight of 196.29 g/mol, XLogP of 2.34, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1-methoxy-2,5,5-trimethylpyrrolidine-3-carbonitrile is sourced from PubChem (CID 123958706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).