C20H41N3O2 — CID 89417571
1-methoxy-4-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)-2,2,6,6-tetramethylpiperidin-4-amine (PubChem CID 89417571) has the molecular formula C20H41N3O2 and a molecular weight of 355.57 g/mol. Its IUPAC name is 1-methoxy-4-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)-2,2,6,6-tetramethylpiperidin-4-amine.
| Compound Name | 1-methoxy-4-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)-2,2,6,6-tetramethylpiperidin-4-amine |
|---|---|
| PubChem CID | 89417571 |
| Molecular Formula | C20H41N3O2 |
| Molecular Weight | 355.57 g/mol |
| Exact Mass | 355.32 |
| IUPAC Name | 1-methoxy-4-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)-2,2,6,6-tetramethylpiperidin-4-amine |
| SMILES | CON1C(C)(C)CC(C2(N)CC(C)(C)N(OC)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C20H41N3O2/c1-16(2)11-15(12-17(3,4)22(16)24-9)20(21)13-18(5,6)23(25-10)19(7,8)14-20/h15H,11-14,21H2,1-10H3 |
| InChIKey | OLEQFBPJWFITGG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 50.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.57 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |