C13H27NO — CID 54376541
4-ethyl-1-methoxy-2,2,4,6,6-pentamethylpiperidine (PubChem CID 54376541) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is 4-ethyl-1-methoxy-2,2,4,6,6-pentamethylpiperidine.
| Compound Name | 4-ethyl-1-methoxy-2,2,4,6,6-pentamethylpiperidine |
|---|---|
| PubChem CID | 54376541 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | 4-ethyl-1-methoxy-2,2,4,6,6-pentamethylpiperidine |
| SMILES | CCC1(C)CC(C)(C)N(OC)C(C)(C)C1 |
| InChI | InChI=1S/C13H27NO/c1-8-13(6)9-11(2,3)14(15-7)12(4,5)10-13/h8-10H2,1-7H3 |
| InChIKey | UWWYORSSBCKYBJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |