About ethyl 2-bromoacetate;zinc
ethyl 2-bromoacetate;zinc (PubChem CID 130407816) has the molecular formula C4H6BrO2Zn-
and a molecular weight of 231.38 g/mol. Its IUPAC name is ethyl 2-bromoacetate;zinc.
Molecular Properties
| Compound Name | ethyl 2-bromoacetate;zinc |
| PubChem CID | 130407816 |
| Molecular Formula | C4H6BrO2Zn- |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 228.88 |
| IUPAC Name | ethyl 2-bromoacetate;zinc |
| SMILES | CCOC(=O)[CH-]Br.[Zn] |
| InChI | InChI=1S/C4H6BrO2.Zn/c1-2-7-4(6)3-5;/h3H,2H2,1H3;/q-1; |
| InChIKey | QIFWAHVLYNYXTH-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-bromoacetate;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-bromoacetate;zinc?
The IUPAC name of ethyl 2-bromoacetate;zinc (CID 130407816) is ethyl 2-bromoacetate;zinc.
What is the SMILES notation for ethyl 2-bromoacetate;zinc?
The canonical SMILES for ethyl 2-bromoacetate;zinc is CCOC(=O)[CH-]Br.[Zn].
What is the InChIKey of ethyl 2-bromoacetate;zinc?
The InChIKey is QIFWAHVLYNYXTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6BrO2.Zn/c1-2-7-4(6)3-5;/h3H,2H2,1H3;/q-1;.
What are the key properties of ethyl 2-bromoacetate;zinc?
ethyl 2-bromoacetate;zinc has a molecular weight of 231.38 g/mol, XLogP of 1.10, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-bromoacetate;zinc is sourced from PubChem (CID 130407816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).