About ethyl 2-bromoacetate;gold(1+)
ethyl 2-bromoacetate;gold(1+) (PubChem CID 174891497) has the molecular formula C4H6AuBrO2
and a molecular weight of 362.96 g/mol. Its IUPAC name is ethyl 2-bromoacetate;gold(1+).
Molecular Properties
| Compound Name | ethyl 2-bromoacetate;gold(1+) |
| PubChem CID | 174891497 |
| Molecular Formula | C4H6AuBrO2 |
| Molecular Weight | 362.96 g/mol |
| Exact Mass | 361.92 |
| IUPAC Name | ethyl 2-bromoacetate;gold(1+) |
| SMILES | CCOC(=O)[CH-]Br.[Au+] |
| InChI | InChI=1S/C4H6BrO2.Au/c1-2-7-4(6)3-5;/h3H,2H2,1H3;/q-1;+1 |
| InChIKey | SEPUXPSHGJCIFY-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.96 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-bromoacetate;gold(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-bromoacetate;gold(1+)?
The IUPAC name of ethyl 2-bromoacetate;gold(1+) (CID 174891497) is ethyl 2-bromoacetate;gold(1+).
What is the SMILES notation for ethyl 2-bromoacetate;gold(1+)?
The canonical SMILES for ethyl 2-bromoacetate;gold(1+) is CCOC(=O)[CH-]Br.[Au+].
What is the InChIKey of ethyl 2-bromoacetate;gold(1+)?
The InChIKey is SEPUXPSHGJCIFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6BrO2.Au/c1-2-7-4(6)3-5;/h3H,2H2,1H3;/q-1;+1.
What are the key properties of ethyl 2-bromoacetate;gold(1+)?
ethyl 2-bromoacetate;gold(1+) has a molecular weight of 362.96 g/mol, XLogP of 1.10, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-bromoacetate;gold(1+) is sourced from PubChem (CID 174891497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).