About zinc bis(ethyl 3-sulfanylpropanoate)
zinc bis(ethyl 3-sulfanylpropanoate) (PubChem CID 87181648) has the molecular formula C10H18O4S2Zn
and a molecular weight of 331.77 g/mol. Its IUPAC name is zinc bis(ethyl 3-sulfanylpropanoate).
Molecular Properties
| Compound Name | zinc bis(ethyl 3-sulfanylpropanoate) |
| PubChem CID | 87181648 |
| Molecular Formula | C10H18O4S2Zn |
| Molecular Weight | 331.77 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | zinc bis(ethyl 3-sulfanylpropanoate) |
| SMILES | CCOC(=O)[CH-]CS.CCOC(=O)[CH-]CS.[Zn+2] |
| InChI | InChI=1S/2C5H9O2S.Zn/c2*1-2-7-5(6)3-4-8;/h2*3,8H,2,4H2,1H3;/q2*-1;+2 |
| InChIKey | IXAPPZUDKPFFDG-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.77 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze zinc bis(ethyl 3-sulfanylpropanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc bis(ethyl 3-sulfanylpropanoate)?
The IUPAC name of zinc bis(ethyl 3-sulfanylpropanoate) (CID 87181648) is zinc bis(ethyl 3-sulfanylpropanoate).
What is the SMILES notation for zinc bis(ethyl 3-sulfanylpropanoate)?
The canonical SMILES for zinc bis(ethyl 3-sulfanylpropanoate) is CCOC(=O)[CH-]CS.CCOC(=O)[CH-]CS.[Zn+2].
What is the InChIKey of zinc bis(ethyl 3-sulfanylpropanoate)?
The InChIKey is IXAPPZUDKPFFDG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H9O2S.Zn/c2*1-2-7-5(6)3-4-8;/h2*3,8H,2,4H2,1H3;/q2*-1;+2.
What are the key properties of zinc bis(ethyl 3-sulfanylpropanoate)?
zinc bis(ethyl 3-sulfanylpropanoate) has a molecular weight of 331.77 g/mol, XLogP of 1.36, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for zinc bis(ethyl 3-sulfanylpropanoate) is sourced from PubChem (CID 87181648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).