C16H13Cl2N3O3S — CID 130408598
4,5-dichloro-1-methyl-N-(4-sulfamoylphenyl)indole-2-carboxamide (PubChem CID 130408598) has the molecular formula C16H13Cl2N3O3S and a molecular weight of 398.27 g/mol. Its IUPAC name is 4,5-dichloro-1-methyl-N-(4-sulfamoylphenyl)indole-2-carboxamide.
| Compound Name | 4,5-dichloro-1-methyl-N-(4-sulfamoylphenyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 130408598 |
| Molecular Formula | C16H13Cl2N3O3S |
| Molecular Weight | 398.27 g/mol |
| Exact Mass | 397.01 |
| IUPAC Name | 4,5-dichloro-1-methyl-N-(4-sulfamoylphenyl)indole-2-carboxamide |
| SMILES | Cn1c(C(=O)Nc2ccc(S(N)(=O)=O)cc2)cc2c(Cl)c(Cl)ccc21 |
| InChI | InChI=1S/C16H13Cl2N3O3S/c1-21-13-7-6-12(17)15(18)11(13)8-14(21)16(22)20-9-2-4-10(5-3-9)25(19,23)24/h2-8H,1H3,(H,20,22)(H2,19,23,24) |
| InChIKey | AVLGFYUCDQOAKY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.27 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |