C20H15ClFN5O3S — CID 145367844
4-chloro-5-fluoro-1-methyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]indole-2-carboxamide (PubChem CID 145367844) has the molecular formula C20H15ClFN5O3S and a molecular weight of 459.89 g/mol. Its IUPAC name is 4-chloro-5-fluoro-1-methyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]indole-2-carboxamide.
| Compound Name | 4-chloro-5-fluoro-1-methyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 145367844 |
| Molecular Formula | C20H15ClFN5O3S |
| Molecular Weight | 459.89 g/mol |
| Exact Mass | 459.06 |
| IUPAC Name | 4-chloro-5-fluoro-1-methyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]indole-2-carboxamide |
| SMILES | Cn1c(C(=O)Nc2ccc(S(=O)(=O)Nc3ncccn3)cc2)cc2c(Cl)c(F)ccc21 |
| InChI | InChI=1S/C20H15ClFN5O3S/c1-27-16-8-7-15(22)18(21)14(16)11-17(27)19(28)25-12-3-5-13(6-4-12)31(29,30)26-20-23-9-2-10-24-20/h2-11H,1H3,(H,25,28)(H,23,24,26) |
| InChIKey | RHKLNGLEYORUFY-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.89 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |