C20H15Cl2N5O3S — CID 130420421
4,5-dichloro-1-methyl-N-[4-(pyrazin-2-ylsulfamoyl)phenyl]indole-2-carboxamide (PubChem CID 130420421) has the molecular formula C20H15Cl2N5O3S and a molecular weight of 476.35 g/mol. Its IUPAC name is 4,5-dichloro-1-methyl-N-[4-(pyrazin-2-ylsulfamoyl)phenyl]indole-2-carboxamide.
| Compound Name | 4,5-dichloro-1-methyl-N-[4-(pyrazin-2-ylsulfamoyl)phenyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 130420421 |
| Molecular Formula | C20H15Cl2N5O3S |
| Molecular Weight | 476.35 g/mol |
| Exact Mass | 475.03 |
| IUPAC Name | 4,5-dichloro-1-methyl-N-[4-(pyrazin-2-ylsulfamoyl)phenyl]indole-2-carboxamide |
| SMILES | Cn1c(C(=O)Nc2ccc(S(=O)(=O)Nc3cnccn3)cc2)cc2c(Cl)c(Cl)ccc21 |
| InChI | InChI=1S/C20H15Cl2N5O3S/c1-27-16-7-6-15(21)19(22)14(16)10-17(27)20(28)25-12-2-4-13(5-3-12)31(29,30)26-18-11-23-8-9-24-18/h2-11H,1H3,(H,24,26)(H,25,28) |
| InChIKey | KYLPVYOAXZYNAC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.35 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |