C21H22F3N3O2S — CID 130410496
N-[6-amino-1-(1,3-benzothiazol-2-yl)-1-hydroxyhexan-2-yl]-2-(trifluoromethyl)benzamide (PubChem CID 130410496) has the molecular formula C21H22F3N3O2S and a molecular weight of 437.49 g/mol. Its IUPAC name is N-[6-amino-1-(1,3-benzothiazol-2-yl)-1-hydroxyhexan-2-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[6-amino-1-(1,3-benzothiazol-2-yl)-1-hydroxyhexan-2-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 130410496 |
| Molecular Formula | C21H22F3N3O2S |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | N-[6-amino-1-(1,3-benzothiazol-2-yl)-1-hydroxyhexan-2-yl]-2-(trifluoromethyl)benzamide |
| SMILES | NCCCCC(NC(=O)c1ccccc1C(F)(F)F)C(O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C21H22F3N3O2S/c22-21(23,24)14-8-2-1-7-13(14)19(29)26-16(10-5-6-12-25)18(28)20-27-15-9-3-4-11-17(15)30-20/h1-4,7-9,11,16,18,28H,5-6,10,12,25H2,(H,26,29) |
| InChIKey | YTWDCFLPZPHWSK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|