C15H19F12NO — CID 130418388
1-[1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)butyl]-4-(trifluoromethyl)piperidine (PubChem CID 130418388) has the molecular formula C15H19F12NO and a molecular weight of 457.30 g/mol. Its IUPAC name is 1-[1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)butyl]-4-(trifluoromethyl)piperidine.
| Compound Name | 1-[1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)butyl]-4-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 130418388 |
| Molecular Formula | C15H19F12NO |
| Molecular Weight | 457.30 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 1-[1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)butyl]-4-(trifluoromethyl)piperidine |
| SMILES | CC(OC(C)C(F)(F)C(F)C(F)(F)F)C(F)(F)C(F)N1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H19F12NO/c1-7(12(18,19)10(16)15(25,26)27)29-8(2)13(20,21)11(17)28-5-3-9(4-6-28)14(22,23)24/h7-11H,3-6H2,1-2H3 |
| InChIKey | OKYAMEFXZJTFGN-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.30 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|