C13H22F5NO — CID 59204134
1-[2-(1,1,1,2,2-pentafluoro-4-methylpentan-3-yl)oxyethyl]piperidine (PubChem CID 59204134) has the molecular formula C13H22F5NO and a molecular weight of 303.31 g/mol. Its IUPAC name is 1-[2-(1,1,1,2,2-pentafluoro-4-methylpentan-3-yl)oxyethyl]piperidine.
| Compound Name | 1-[2-(1,1,1,2,2-pentafluoro-4-methylpentan-3-yl)oxyethyl]piperidine |
|---|---|
| PubChem CID | 59204134 |
| Molecular Formula | C13H22F5NO |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 1-[2-(1,1,1,2,2-pentafluoro-4-methylpentan-3-yl)oxyethyl]piperidine |
| SMILES | CC(C)C(OCCN1CCCCC1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H22F5NO/c1-10(2)11(12(14,15)13(16,17)18)20-9-8-19-6-4-3-5-7-19/h10-11H,3-9H2,1-2H3 |
| InChIKey | UVWDNKFHSHPSTC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|