C14H22F7NO — CID 59204103
1-[2-(4,4,5,5,6,6,6-heptafluoro-2-methylhexan-3-yl)oxyethyl]piperidine (PubChem CID 59204103) has the molecular formula C14H22F7NO and a molecular weight of 353.32 g/mol. Its IUPAC name is 1-[2-(4,4,5,5,6,6,6-heptafluoro-2-methylhexan-3-yl)oxyethyl]piperidine.
| Compound Name | 1-[2-(4,4,5,5,6,6,6-heptafluoro-2-methylhexan-3-yl)oxyethyl]piperidine |
|---|---|
| PubChem CID | 59204103 |
| Molecular Formula | C14H22F7NO |
| Molecular Weight | 353.32 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 1-[2-(4,4,5,5,6,6,6-heptafluoro-2-methylhexan-3-yl)oxyethyl]piperidine |
| SMILES | CC(C)C(OCCN1CCCCC1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H22F7NO/c1-10(2)11(12(15,16)13(17,18)14(19,20)21)23-9-8-22-6-4-3-5-7-22/h10-11H,3-9H2,1-2H3 |
| InChIKey | KVRYMCHAXDTOKU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.32 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|