C16H18F15NO — CID 130418418
1-[(1R)-1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)butyl]-3,5-bis(trifluoromethyl)piperidine (PubChem CID 130418418) has the molecular formula C16H18F15NO and a molecular weight of 525.30 g/mol. Its IUPAC name is 1-[(1R)-1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)butyl]-3,5-bis(trifluoromethyl)piperidine.
| Compound Name | 1-[(1R)-1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)butyl]-3,5-bis(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 130418418 |
| Molecular Formula | C16H18F15NO |
| Molecular Weight | 525.30 g/mol |
| Exact Mass | 525.11 |
| IUPAC Name | 1-[(1R)-1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)butyl]-3,5-bis(trifluoromethyl)piperidine |
| SMILES | CC(OC(C)C(F)(F)[C@@H](F)N1CC(C(F)(F)F)CC(C(F)(F)F)C1)C(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C16H18F15NO/c1-6(12(19,20)10(17)16(29,30)31)33-7(2)13(21,22)11(18)32-4-8(14(23,24)25)3-9(5-32)15(26,27)28/h6-11H,3-5H2,1-2H3/t6?,7?,8?,9?,10?,11-/m0/s1 |
| InChIKey | SFVGFPKGAKEPFY-QTDCSAEMSA-N |
| XLogP | 6.31 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.30 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|