C26H37N5O2 — CID 130418664
7-[(3aS,4R,6S,6aR)-6-[(8-ethyl-8-azaspiro[4.5]dec-3-en-4-yl)methyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 130418664) has the molecular formula C26H37N5O2 and a molecular weight of 451.62 g/mol. Its IUPAC name is 7-[(3aS,4R,6S,6aR)-6-[(8-ethyl-8-azaspiro[4.5]dec-3-en-4-yl)methyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-[(3aS,4R,6S,6aR)-6-[(8-ethyl-8-azaspiro[4.5]dec-3-en-4-yl)methyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 130418664 |
| Molecular Formula | C26H37N5O2 |
| Molecular Weight | 451.62 g/mol |
| Exact Mass | 451.29 |
| IUPAC Name | 7-[(3aS,4R,6S,6aR)-6-[(8-ethyl-8-azaspiro[4.5]dec-3-en-4-yl)methyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CCN1CCC2(CCC=C2C[C@H]2C[C@@H](n3ccc4c(N)ncnc43)[C@@H]3OC(C)(C)O[C@H]23)CC1 |
| InChI | InChI=1S/C26H37N5O2/c1-4-30-12-9-26(10-13-30)8-5-6-18(26)14-17-15-20(22-21(17)32-25(2,3)33-22)31-11-7-19-23(27)28-16-29-24(19)31/h6-7,11,16-17,20-22H,4-5,8-10,12-15H2,1-3H3,(H2,27,28,29)/t17-,20+,21+,22-/m0/s1 |
| InChIKey | VTYMILLVQHRCPK-UPZYVNNASA-N |
| XLogP | 4.31 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.62 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|