C27H32N6O2 — CID 162490553
8-[4-[(3aS,4R,6S,6aR)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]butyl]quinolin-3-amine (PubChem CID 162490553) has the molecular formula C27H32N6O2 and a molecular weight of 472.59 g/mol. Its IUPAC name is 8-[4-[(3aS,4R,6S,6aR)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]butyl]quinolin-3-amine.
| Compound Name | 8-[4-[(3aS,4R,6S,6aR)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]butyl]quinolin-3-amine |
|---|---|
| PubChem CID | 162490553 |
| Molecular Formula | C27H32N6O2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | 8-[4-[(3aS,4R,6S,6aR)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]butyl]quinolin-3-amine |
| SMILES | CC1(C)O[C@@H]2[C@@H](CCCCc3cccc4cc(N)cnc34)C[C@@H](n3ccc4c(N)ncnc43)[C@@H]2O1 |
| InChI | InChI=1S/C27H32N6O2/c1-27(2)34-23-18(7-4-3-6-16-8-5-9-17-12-19(28)14-30-22(16)17)13-21(24(23)35-27)33-11-10-20-25(29)31-15-32-26(20)33/h5,8-12,14-15,18,21,23-24H,3-4,6-7,13,28H2,1-2H3,(H2,29,31,32)/t18-,21+,23+,24-/m0/s1 |
| InChIKey | RKKSMBMMFAPPEI-DAQNBYSMSA-N |
| XLogP | 4.64 |
| TPSA | 114.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|