C28H34N6O — CID 166868302
8-[4-[(3aS,4R,6S,6aR)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl]butyl]quinolin-2-amine (PubChem CID 166868302) has the molecular formula C28H34N6O and a molecular weight of 470.62 g/mol. Its IUPAC name is 8-[4-[(3aS,4R,6S,6aR)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl]butyl]quinolin-2-amine.
| Compound Name | 8-[4-[(3aS,4R,6S,6aR)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl]butyl]quinolin-2-amine |
|---|---|
| PubChem CID | 166868302 |
| Molecular Formula | C28H34N6O |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.28 |
| IUPAC Name | 8-[4-[(3aS,4R,6S,6aR)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl]butyl]quinolin-2-amine |
| SMILES | CC1(C)C[C@@H]2[C@H](O1)[C@@H](CCCCc1cccc3ccc(N)nc13)C[C@H]2n1ccc2c(N)ncnc21 |
| InChI | InChI=1S/C28H34N6O/c1-28(2)15-21-22(34-13-12-20-26(30)31-16-32-27(20)34)14-19(25(21)35-28)7-4-3-6-17-8-5-9-18-10-11-23(29)33-24(17)18/h5,8-13,16,19,21-22,25H,3-4,6-7,14-15H2,1-2H3,(H2,29,33)(H2,30,31,32)/t19-,21-,22+,25+/m0/s1 |
| InChIKey | NXQMNQKODKTMCM-KUQPJALBSA-N |
| XLogP | 5.30 |
| TPSA | 104.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|