C24H28N6O2 — CID 134416886
(1R,2S,3R,5S)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[4-(8-aminoquinolin-3-yl)butyl]cyclopentane-1,2-diol (PubChem CID 134416886) has the molecular formula C24H28N6O2 and a molecular weight of 432.53 g/mol. Its IUPAC name is (1R,2S,3R,5S)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[4-(8-aminoquinolin-3-yl)butyl]cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5S)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[4-(8-aminoquinolin-3-yl)butyl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 134416886 |
| Molecular Formula | C24H28N6O2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | (1R,2S,3R,5S)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[4-(8-aminoquinolin-3-yl)butyl]cyclopentane-1,2-diol |
| SMILES | Nc1ncnc2c1ccn2[C@@H]1C[C@H](CCCCc2cnc3c(N)cccc3c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C24H28N6O2/c25-18-7-3-6-15-10-14(12-27-20(15)18)4-1-2-5-16-11-19(22(32)21(16)31)30-9-8-17-23(26)28-13-29-24(17)30/h3,6-10,12-13,16,19,21-22,31-32H,1-2,4-5,11,25H2,(H2,26,28,29)/t16-,19+,21+,22-/m0/s1 |
| InChIKey | DKHFCJKLCVMXON-MQYXYMALSA-N |
| XLogP | 2.84 |
| TPSA | 136.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|