C20H25N5O2 — CID 139449593
(1R,2S,3R,5S)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-(4-pyridin-2-ylbutyl)cyclopentane-1,2-diol (PubChem CID 139449593) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is (1R,2S,3R,5S)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-(4-pyridin-2-ylbutyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5S)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-(4-pyridin-2-ylbutyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 139449593 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | (1R,2S,3R,5S)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-(4-pyridin-2-ylbutyl)cyclopentane-1,2-diol |
| SMILES | Nc1ncnc2c1ccn2[C@@H]1C[C@H](CCCCc2ccccn2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H25N5O2/c21-19-15-8-10-25(20(15)24-12-23-19)16-11-13(17(26)18(16)27)5-1-2-6-14-7-3-4-9-22-14/h3-4,7-10,12-13,16-18,26-27H,1-2,5-6,11H2,(H2,21,23,24)/t13-,16+,17+,18-/m0/s1 |
| InChIKey | RKHVNHJLZJDQOV-LIRZEXBASA-N |
| XLogP | 2.10 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|