C21H32N6O2 — CID 155769060
(1R,2S,3R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[(8-methyl-1,8-diazaspiro[4.5]decan-1-yl)methyl]cyclopentane-1,2-diol (PubChem CID 155769060) has the molecular formula C21H32N6O2 and a molecular weight of 400.53 g/mol. Its IUPAC name is (1R,2S,3R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[(8-methyl-1,8-diazaspiro[4.5]decan-1-yl)methyl]cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[(8-methyl-1,8-diazaspiro[4.5]decan-1-yl)methyl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 155769060 |
| Molecular Formula | C21H32N6O2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | (1R,2S,3R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[(8-methyl-1,8-diazaspiro[4.5]decan-1-yl)methyl]cyclopentane-1,2-diol |
| SMILES | CN1CCC2(CCCN2CC2C[C@@H](n3ccc4c(N)ncnc43)[C@H](O)[C@@H]2O)CC1 |
| InChI | InChI=1S/C21H32N6O2/c1-25-9-5-21(6-10-25)4-2-7-26(21)12-14-11-16(18(29)17(14)28)27-8-3-15-19(22)23-13-24-20(15)27/h3,8,13-14,16-18,28-29H,2,4-7,9-12H2,1H3,(H2,22,23,24)/t14?,16-,17-,18+/m1/s1 |
| InChIKey | XDNIHPJBXZIDLC-QDZFIJTISA-N |
| XLogP | 0.86 |
| TPSA | 103.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |