C21H32N6O2 — CID 167461711
(1S,2R,3R,5R)-3-(1,8-diazaspiro[4.5]decan-1-ylmethyl)-5-[4-(methylamino)pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentane-1,2-diol (PubChem CID 167461711) has the molecular formula C21H32N6O2 and a molecular weight of 400.53 g/mol. Its IUPAC name is (1S,2R,3R,5R)-3-(1,8-diazaspiro[4.5]decan-1-ylmethyl)-5-[4-(methylamino)pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentane-1,2-diol.
| Compound Name | (1S,2R,3R,5R)-3-(1,8-diazaspiro[4.5]decan-1-ylmethyl)-5-[4-(methylamino)pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 167461711 |
| Molecular Formula | C21H32N6O2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | (1S,2R,3R,5R)-3-(1,8-diazaspiro[4.5]decan-1-ylmethyl)-5-[4-(methylamino)pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentane-1,2-diol |
| SMILES | CNc1ncnc2c1ccn2[C@@H]1C[C@H](CN2CCCC23CCNCC3)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C21H32N6O2/c1-22-19-15-3-10-27(20(15)25-13-24-19)16-11-14(17(28)18(16)29)12-26-9-2-4-21(26)5-7-23-8-6-21/h3,10,13-14,16-18,23,28-29H,2,4-9,11-12H2,1H3,(H,22,24,25)/t14-,16-,17-,18+/m1/s1 |
| InChIKey | FCNPNMMSXXRSRI-DDBAPUKQSA-N |
| XLogP | 0.97 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |